C22H22N4O4 — CID 11742058
[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]-morpholin-4-ylmethanone (PubChem CID 11742058) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is [5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 11742058 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(-c2nnc(C(=O)N3CCOCC3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O4/c1-28-17-7-3-15(4-8-17)19-20(16-5-9-18(29-2)10-6-16)24-25-21(23-19)22(27)26-11-13-30-14-12-26/h3-10H,11-14H2,1-2H3 |
| InChIKey | RCOOTUFOKPGXQM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |