C15H22FNO2 — CID 117421917
3-[5-(2-fluoropropan-2-yl)-2,4-dimethoxyphenyl]pyrrolidine (PubChem CID 117421917) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 3-[5-(2-fluoropropan-2-yl)-2,4-dimethoxyphenyl]pyrrolidine.
| Compound Name | 3-[5-(2-fluoropropan-2-yl)-2,4-dimethoxyphenyl]pyrrolidine |
|---|---|
| PubChem CID | 117421917 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3-[5-(2-fluoropropan-2-yl)-2,4-dimethoxyphenyl]pyrrolidine |
| SMILES | COc1cc(OC)c(C(C)(C)F)cc1C1CCNC1 |
| InChI | InChI=1S/C15H22FNO2/c1-15(2,16)12-7-11(10-5-6-17-9-10)13(18-3)8-14(12)19-4/h7-8,10,17H,5-6,9H2,1-4H3 |
| InChIKey | QOFBQLWIMGEICG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |