C14H19F2NO2 — CID 117430926
3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]piperidine (PubChem CID 117430926) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]piperidine.
| Compound Name | 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]piperidine |
|---|---|
| PubChem CID | 117430926 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-[5-(difluoromethyl)-2,4-dimethoxyphenyl]piperidine |
| SMILES | COc1cc(OC)c(C2CCCNC2)cc1C(F)F |
| InChI | InChI=1S/C14H19F2NO2/c1-18-12-7-13(19-2)11(14(15)16)6-10(12)9-4-3-5-17-8-9/h6-7,9,14,17H,3-5,8H2,1-2H3 |
| InChIKey | WKMYTPOZOGXPGR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |