C18H28N2O2 — CID 117489901
1-(2,5-dimethoxy-4-piperidin-3-ylphenyl)piperidine (PubChem CID 117489901) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-4-piperidin-3-ylphenyl)piperidine.
| Compound Name | 1-(2,5-dimethoxy-4-piperidin-3-ylphenyl)piperidine |
|---|---|
| PubChem CID | 117489901 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(2,5-dimethoxy-4-piperidin-3-ylphenyl)piperidine |
| SMILES | COc1cc(N2CCCCC2)c(OC)cc1C1CCCNC1 |
| InChI | InChI=1S/C18H28N2O2/c1-21-17-12-16(20-9-4-3-5-10-20)18(22-2)11-15(17)14-7-6-8-19-13-14/h11-12,14,19H,3-10,13H2,1-2H3 |
| InChIKey | LXDBFVUQWXOPNG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |