C13H18BrNO2 — CID 94713053
(3R)-3-(4-bromo-2,5-dimethoxyphenyl)piperidine (PubChem CID 94713053) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (3R)-3-(4-bromo-2,5-dimethoxyphenyl)piperidine.
| Compound Name | (3R)-3-(4-bromo-2,5-dimethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 94713053 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3R)-3-(4-bromo-2,5-dimethoxyphenyl)piperidine |
| SMILES | COc1cc([C@H]2CCCNC2)c(OC)cc1Br |
| InChI | InChI=1S/C13H18BrNO2/c1-16-12-7-11(14)13(17-2)6-10(12)9-4-3-5-15-8-9/h6-7,9,15H,3-5,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | ULJHXMHMDJQESG-VIFPVBQESA-N |
| XLogP | 2.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |