C13H15ClO4 — CID 117429667
1-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117429667) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117429667 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-(2-chloro-4-hydroxy-3-methoxy-6-methylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | COc1c(O)cc(C)c(C2(C(=O)O)CCC2)c1Cl |
| InChI | InChI=1S/C13H15ClO4/c1-7-6-8(15)11(18-2)10(14)9(7)13(12(16)17)4-3-5-13/h6,15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | SBGANWXDBHLEGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |