1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid

C13H15ClO2 — CID 84799391

IUPAC1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid
SMILESCc1ccc(C)c(C2(C(=O)O)CCC2)c1Cl
InChIInChI=1S/C13H15ClO2/c1-8-4-5-9(2)11(14)10(8)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16)
InChIKeyAGFOHCOTXVUZTC-UHFFFAOYSA-N
MW238.71 g/mol
LogP3.46
Rot. Bonds2

About 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid

1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 84799391) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid
PubChem CID84799391
Molecular FormulaC13H15ClO2
Molecular Weight238.71 g/mol
Exact Mass238.08
IUPAC Name1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid
SMILESCc1ccc(C)c(C2(C(=O)O)CCC2)c1Cl
InChIInChI=1S/C13H15ClO2/c1-8-4-5-9(2)11(14)10(8)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16)
InChIKeyAGFOHCOTXVUZTC-UHFFFAOYSA-N
XLogP3.46
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.71
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid (CID 84799391) is 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid is Cc1ccc(C)c(C2(C(=O)O)CCC2)c1Cl.
What is the InChIKey of 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid?
The InChIKey is AGFOHCOTXVUZTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO2/c1-8-4-5-9(2)11(14)10(8)13(12(15)16)6-3-7-13/h4-5H,3,6-7H2,1-2H3,(H,15,16).
What are the key properties of 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid?
1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid has a molecular weight of 238.71 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-3,6-dimethylphenyl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 84799391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).