C13H15ClO2S — CID 117430121
1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropan-1-ol (PubChem CID 117430121) has the molecular formula C13H15ClO2S and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropan-1-ol.
| Compound Name | 1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117430121 |
| Molecular Formula | C13H15ClO2S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropan-1-ol |
| SMILES | OC1(c2ccc(OC3CCSC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H15ClO2S/c14-11-7-9(13(15)4-5-13)1-2-12(11)16-10-3-6-17-8-10/h1-2,7,10,15H,3-6,8H2 |
| InChIKey | IPMRHWSIQKOFII-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |