C15H20ClNOS — CID 117479613
1-[1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropyl]ethanamine (PubChem CID 117479613) has the molecular formula C15H20ClNOS and a molecular weight of 297.85 g/mol. Its IUPAC name is 1-[1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropyl]ethanamine.
| Compound Name | 1-[1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 117479613 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[1-[3-chloro-4-(thiolan-3-yloxy)phenyl]cyclopropyl]ethanamine |
| SMILES | CC(N)C1(c2ccc(OC3CCSC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H20ClNOS/c1-10(17)15(5-6-15)11-2-3-14(13(16)8-11)18-12-4-7-19-9-12/h2-3,8,10,12H,4-7,9,17H2,1H3 |
| InChIKey | NQRPSPSCXATBOZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |