C18H28N2O2 — CID 117489876
1-[1-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]cyclopropyl]ethanamine (PubChem CID 117489876) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-[1-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]cyclopropyl]ethanamine.
| Compound Name | 1-[1-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 117489876 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[1-[3-methoxy-4-(1-methylpiperidin-4-yl)oxyphenyl]cyclopropyl]ethanamine |
| SMILES | COc1cc(C2(C(C)N)CC2)ccc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-13(19)18(8-9-18)14-4-5-16(17(12-14)21-3)22-15-6-10-20(2)11-7-15/h4-5,12-13,15H,6-11,19H2,1-3H3 |
| InChIKey | GXEQHSRVRPWTSA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |