C16H17NO3 — CID 117431014
3-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)piperidine (PubChem CID 117431014) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)piperidine.
| Compound Name | 3-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)piperidine |
|---|---|
| PubChem CID | 117431014 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-(4-methoxyfuro[2,3-f][1]benzofuran-8-yl)piperidine |
| SMILES | COc1c2ccoc2c(C2CCCNC2)c2ccoc12 |
| InChI | InChI=1S/C16H17NO3/c1-18-15-12-5-8-19-14(12)13(10-3-2-6-17-9-10)11-4-7-20-16(11)15/h4-5,7-8,10,17H,2-3,6,9H2,1H3 |
| InChIKey | RPFKRQCGMLKWFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |