C15H22ClNO — CID 117116459
3-(3-chloro-4-methoxy-2,5,6-trimethylphenyl)piperidine (PubChem CID 117116459) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxy-2,5,6-trimethylphenyl)piperidine.
| Compound Name | 3-(3-chloro-4-methoxy-2,5,6-trimethylphenyl)piperidine |
|---|---|
| PubChem CID | 117116459 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-(3-chloro-4-methoxy-2,5,6-trimethylphenyl)piperidine |
| SMILES | COc1c(C)c(C)c(C2CCCNC2)c(C)c1Cl |
| InChI | InChI=1S/C15H22ClNO/c1-9-10(2)15(18-4)14(16)11(3)13(9)12-6-5-7-17-8-12/h12,17H,5-8H2,1-4H3 |
| InChIKey | VVCMPTMZPNFNSU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |