C14H20ClNO — CID 117387979
3-(5-chloro-3-methoxy-2,4-dimethylphenyl)piperidine (PubChem CID 117387979) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-(5-chloro-3-methoxy-2,4-dimethylphenyl)piperidine.
| Compound Name | 3-(5-chloro-3-methoxy-2,4-dimethylphenyl)piperidine |
|---|---|
| PubChem CID | 117387979 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-(5-chloro-3-methoxy-2,4-dimethylphenyl)piperidine |
| SMILES | COc1c(C)c(Cl)cc(C2CCCNC2)c1C |
| InChI | InChI=1S/C14H20ClNO/c1-9-12(11-5-4-6-16-8-11)7-13(15)10(2)14(9)17-3/h7,11,16H,4-6,8H2,1-3H3 |
| InChIKey | DWQPHKYLVWRVKC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |