C14H20ClNO2 — CID 117427657
3-(5-chloro-2,3-dimethoxy-4-methylphenyl)piperidine (PubChem CID 117427657) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 3-(5-chloro-2,3-dimethoxy-4-methylphenyl)piperidine.
| Compound Name | 3-(5-chloro-2,3-dimethoxy-4-methylphenyl)piperidine |
|---|---|
| PubChem CID | 117427657 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(5-chloro-2,3-dimethoxy-4-methylphenyl)piperidine |
| SMILES | COc1c(C2CCCNC2)cc(Cl)c(C)c1OC |
| InChI | InChI=1S/C14H20ClNO2/c1-9-12(15)7-11(10-5-4-6-16-8-10)14(18-3)13(9)17-2/h7,10,16H,4-6,8H2,1-3H3 |
| InChIKey | AYPDLNZFOZDDQS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |