C13H16ClNO2 — CID 117387256
3-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)piperidine (PubChem CID 117387256) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 3-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)piperidine.
| Compound Name | 3-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)piperidine |
|---|---|
| PubChem CID | 117387256 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)piperidine |
| SMILES | Cc1c(C2CCCNC2)cc(Cl)c2c1OCO2 |
| InChI | InChI=1S/C13H16ClNO2/c1-8-10(9-3-2-4-15-6-9)5-11(14)13-12(8)16-7-17-13/h5,9,15H,2-4,6-7H2,1H3 |
| InChIKey | QBGLGQBEKBTRQJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |