C13H17NO2 — CID 84684757
3-(4-methyl-1,3-benzodioxol-5-yl)piperidine (PubChem CID 84684757) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(4-methyl-1,3-benzodioxol-5-yl)piperidine.
| Compound Name | 3-(4-methyl-1,3-benzodioxol-5-yl)piperidine |
|---|---|
| PubChem CID | 84684757 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(4-methyl-1,3-benzodioxol-5-yl)piperidine |
| SMILES | Cc1c(C2CCCNC2)ccc2c1OCO2 |
| InChI | InChI=1S/C13H17NO2/c1-9-11(10-3-2-6-14-7-10)4-5-12-13(9)16-8-15-12/h4-5,10,14H,2-3,6-8H2,1H3 |
| InChIKey | GPRPNCHCEPMCTK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |