C16H24ClNO2 — CID 117479597
3-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)piperidine (PubChem CID 117479597) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)piperidine.
| Compound Name | 3-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)piperidine |
|---|---|
| PubChem CID | 117479597 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-(5-chloro-3,4-dimethoxy-2-propan-2-ylphenyl)piperidine |
| SMILES | COc1c(Cl)cc(C2CCCNC2)c(C(C)C)c1OC |
| InChI | InChI=1S/C16H24ClNO2/c1-10(2)14-12(11-6-5-7-18-9-11)8-13(17)15(19-3)16(14)20-4/h8,10-11,18H,5-7,9H2,1-4H3 |
| InChIKey | LVOQIUFACRSKRG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |