C13H18ClNO3 — CID 117432185
3-chloro-4,5-dimethoxy-2-piperidin-2-ylphenol (PubChem CID 117432185) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-2-piperidin-2-ylphenol.
| Compound Name | 3-chloro-4,5-dimethoxy-2-piperidin-2-ylphenol |
|---|---|
| PubChem CID | 117432185 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-2-piperidin-2-ylphenol |
| SMILES | COc1cc(O)c(C2CCCCN2)c(Cl)c1OC |
| InChI | InChI=1S/C13H18ClNO3/c1-17-10-7-9(16)11(12(14)13(10)18-2)8-5-3-4-6-15-8/h7-8,15-16H,3-6H2,1-2H3 |
| InChIKey | YPZDVACIQMOGMH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|