C12H16O5S — CID 117433736
ethyl 2-hydroxy-2-[4-(methylsulfonylmethyl)phenyl]acetate (PubChem CID 117433736) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-[4-(methylsulfonylmethyl)phenyl]acetate.
| Compound Name | ethyl 2-hydroxy-2-[4-(methylsulfonylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 117433736 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | ethyl 2-hydroxy-2-[4-(methylsulfonylmethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16O5S/c1-3-17-12(14)11(13)10-6-4-9(5-7-10)8-18(2,15)16/h4-7,11,13H,3,8H2,1-2H3 |
| InChIKey | DFNNBMYFLXZPEE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |