C17H24N2O — CID 117434056
[1-(2-propan-2-yl-1,3-benzoxazol-5-yl)cyclohexyl]methanamine (PubChem CID 117434056) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is [1-(2-propan-2-yl-1,3-benzoxazol-5-yl)cyclohexyl]methanamine.
| Compound Name | [1-(2-propan-2-yl-1,3-benzoxazol-5-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 117434056 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [1-(2-propan-2-yl-1,3-benzoxazol-5-yl)cyclohexyl]methanamine |
| SMILES | CC(C)c1nc2cc(C3(CN)CCCCC3)ccc2o1 |
| InChI | InChI=1S/C17H24N2O/c1-12(2)16-19-14-10-13(6-7-15(14)20-16)17(11-18)8-4-3-5-9-17/h6-7,10,12H,3-5,8-9,11,18H2,1-2H3 |
| InChIKey | XQIBACWGXKMNMU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |