C17H24N2O — CID 117434079
2-tert-butyl-5-(piperidin-3-ylmethyl)-1,3-benzoxazole (PubChem CID 117434079) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-tert-butyl-5-(piperidin-3-ylmethyl)-1,3-benzoxazole.
| Compound Name | 2-tert-butyl-5-(piperidin-3-ylmethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 117434079 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-tert-butyl-5-(piperidin-3-ylmethyl)-1,3-benzoxazole |
| SMILES | CC(C)(C)c1nc2cc(CC3CCCNC3)ccc2o1 |
| InChI | InChI=1S/C17H24N2O/c1-17(2,3)16-19-14-10-12(6-7-15(14)20-16)9-13-5-4-8-18-11-13/h6-7,10,13,18H,4-5,8-9,11H2,1-3H3 |
| InChIKey | GYLDWUYFQAZAKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |