C14H18F3NO — CID 117435548
4-[5-(1,1-difluoroethyl)-3-fluoro-2-methoxyphenyl]piperidine (PubChem CID 117435548) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-[5-(1,1-difluoroethyl)-3-fluoro-2-methoxyphenyl]piperidine.
| Compound Name | 4-[5-(1,1-difluoroethyl)-3-fluoro-2-methoxyphenyl]piperidine |
|---|---|
| PubChem CID | 117435548 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-[5-(1,1-difluoroethyl)-3-fluoro-2-methoxyphenyl]piperidine |
| SMILES | COc1c(F)cc(C(C)(F)F)cc1C1CCNCC1 |
| InChI | InChI=1S/C14H18F3NO/c1-14(16,17)10-7-11(9-3-5-18-6-4-9)13(19-2)12(15)8-10/h7-9,18H,3-6H2,1-2H3 |
| InChIKey | YIRRCUYHDQVBAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |