C14H18F3NO2 — CID 117467271
4-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]piperidine (PubChem CID 117467271) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 4-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 117467271 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]piperidine |
| SMILES | COc1cc(C2CCNCC2)c(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C14H18F3NO2/c1-19-12-7-10(9-3-5-18-6-4-9)11(14(15,16)17)8-13(12)20-2/h7-9,18H,3-6H2,1-2H3 |
| InChIKey | XWDVRBBAZZKONW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |