C13H14F3NS — CID 117435723
2-methyl-1-[2-(trifluoromethyl)-1-benzothiophen-5-yl]propan-2-amine (PubChem CID 117435723) has the molecular formula C13H14F3NS and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-methyl-1-[2-(trifluoromethyl)-1-benzothiophen-5-yl]propan-2-amine.
| Compound Name | 2-methyl-1-[2-(trifluoromethyl)-1-benzothiophen-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 117435723 |
| Molecular Formula | C13H14F3NS |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-methyl-1-[2-(trifluoromethyl)-1-benzothiophen-5-yl]propan-2-amine |
| SMILES | CC(C)(N)Cc1ccc2sc(C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C13H14F3NS/c1-12(2,17)7-8-3-4-10-9(5-8)6-11(18-10)13(14,15)16/h3-6H,7,17H2,1-2H3 |
| InChIKey | AYPAXJGCFZUARD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |