C20H8F6S2 — CID 88902918
6,16-bis(trifluoromethyl)-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene (PubChem CID 88902918) has the molecular formula C20H8F6S2 and a molecular weight of 426.41 g/mol. Its IUPAC name is 6,16-bis(trifluoromethyl)-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene.
| Compound Name | 6,16-bis(trifluoromethyl)-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
|---|---|
| PubChem CID | 88902918 |
| Molecular Formula | C20H8F6S2 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 6,16-bis(trifluoromethyl)-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
| SMILES | FC(F)(F)c1cc2c(ccc3cc4c(ccc5sc(C(F)(F)F)cc54)cc32)s1 |
| InChI | InChI=1S/C20H8F6S2/c21-19(22,23)17-7-13-11-6-10-2-4-16-14(8-18(28-16)20(24,25)26)12(10)5-9(11)1-3-15(13)27-17/h1-8H |
| InChIKey | NUUCHMKEUSTHIE-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|