C20H14O2S2 — CID 58426675
6,16-dimethoxy-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene (PubChem CID 58426675) has the molecular formula C20H14O2S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 6,16-dimethoxy-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene.
| Compound Name | 6,16-dimethoxy-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
|---|---|
| PubChem CID | 58426675 |
| Molecular Formula | C20H14O2S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 6,16-dimethoxy-7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
| SMILES | COc1cc2c(ccc3cc4c(ccc5sc(OC)cc54)cc32)s1 |
| InChI | InChI=1S/C20H14O2S2/c1-21-19-9-15-13-7-12-4-6-18-16(10-20(22-2)24-18)14(12)8-11(13)3-5-17(15)23-19/h3-10H,1-2H3 |
| InChIKey | FAYVEFZWTDPQQV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|