C15H19N3O2 — CID 117436005
1-[4-(1-aminocyclopentyl)phenyl]piperazine-2,5-dione (PubChem CID 117436005) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-[4-(1-aminocyclopentyl)phenyl]piperazine-2,5-dione.
| Compound Name | 1-[4-(1-aminocyclopentyl)phenyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 117436005 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[4-(1-aminocyclopentyl)phenyl]piperazine-2,5-dione |
| SMILES | NC1(c2ccc(N3CC(=O)NCC3=O)cc2)CCCC1 |
| InChI | InChI=1S/C15H19N3O2/c16-15(7-1-2-8-15)11-3-5-12(6-4-11)18-10-13(19)17-9-14(18)20/h3-6H,1-2,7-10,16H2,(H,17,19) |
| InChIKey | STGIREHABZVZDC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |