C10H10FN3O2 — CID 82512820
1-(3-amino-4-fluorophenyl)piperazine-2,5-dione (PubChem CID 82512820) has the molecular formula C10H10FN3O2 and a molecular weight of 223.21 g/mol. Its IUPAC name is 1-(3-amino-4-fluorophenyl)piperazine-2,5-dione.
| Compound Name | 1-(3-amino-4-fluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 82512820 |
| Molecular Formula | C10H10FN3O2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(3-amino-4-fluorophenyl)piperazine-2,5-dione |
| SMILES | Nc1cc(N2CC(=O)NCC2=O)ccc1F |
| InChI | InChI=1S/C10H10FN3O2/c11-7-2-1-6(3-8(7)12)14-5-9(15)13-4-10(14)16/h1-3H,4-5,12H2,(H,13,15) |
| InChIKey | NJVRASSYGOGYLB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|