C17H23NO2 — CID 117436332
[1-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)cyclopropyl]methanamine (PubChem CID 117436332) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [1-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)cyclopropyl]methanamine.
| Compound Name | [1-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117436332 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [1-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)cyclopropyl]methanamine |
| SMILES | Cc1c2c(c(C3(CN)CC3)c3c1OC(C)C3)OC(C)C2 |
| InChI | InChI=1S/C17H23NO2/c1-9-6-12-11(3)15-13(7-10(2)19-15)14(16(12)20-9)17(8-18)4-5-17/h9-10H,4-8,18H2,1-3H3 |
| InChIKey | LOMNGOXKEZVZKE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |