C13H10N2O5 — CID 117437867
5-(5-cyano-2,3-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117437867) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-(5-cyano-2,3-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(5-cyano-2,3-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117437867 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-(5-cyano-2,3-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1cc(C#N)cc(-c2cc(C(=O)O)no2)c1OC |
| InChI | InChI=1S/C13H10N2O5/c1-18-11-4-7(6-14)3-8(12(11)19-2)10-5-9(13(16)17)15-20-10/h3-5H,1-2H3,(H,16,17) |
| InChIKey | PKEVHQSKHMYHOR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |