About 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid
5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117485824) has the molecular formula C12H9ClFNO5
and a molecular weight of 301.66 g/mol. Its IUPAC name is 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 117485824 |
| Molecular Formula | C12H9ClFNO5 |
| Molecular Weight | 301.66 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1c(Cl)cc(-c2cc(C(=O)O)no2)c(OC)c1F |
| InChI | InChI=1S/C12H9ClFNO5/c1-18-10-5(3-6(13)11(19-2)9(10)14)8-4-7(12(16)17)15-20-8/h3-4H,1-2H3,(H,16,17) |
| InChIKey | KNRAPQONSPCDKG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.66 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid (CID 117485824) is 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid is COc1c(Cl)cc(-c2cc(C(=O)O)no2)c(OC)c1F.
What is the InChIKey of 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is KNRAPQONSPCDKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClFNO5/c1-18-10-5(3-6(13)11(19-2)9(10)14)8-4-7(12(16)17)15-20-8/h3-4H,1-2H3,(H,16,17).
What are the key properties of 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid?
5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 301.66 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 117485824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).