C11H6ClF2NO4 — CID 117467926
5-(5-chloro-2,4-difluoro-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117467926) has the molecular formula C11H6ClF2NO4 and a molecular weight of 289.62 g/mol. Its IUPAC name is 5-(5-chloro-2,4-difluoro-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(5-chloro-2,4-difluoro-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117467926 |
| Molecular Formula | C11H6ClF2NO4 |
| Molecular Weight | 289.62 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-(5-chloro-2,4-difluoro-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1c(F)c(Cl)cc(-c2cc(C(=O)O)no2)c1F |
| InChI | InChI=1S/C11H6ClF2NO4/c1-18-10-8(13)4(2-5(12)9(10)14)7-3-6(11(16)17)15-19-7/h2-3H,1H3,(H,16,17) |
| InChIKey | UFWUHTBRSALVSW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|