C11H6ClF2NO3 — CID 117436840
5-(3-chloro-2,6-difluoro-5-methylphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117436840) has the molecular formula C11H6ClF2NO3 and a molecular weight of 273.62 g/mol. Its IUPAC name is 5-(3-chloro-2,6-difluoro-5-methylphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-2,6-difluoro-5-methylphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117436840 |
| Molecular Formula | C11H6ClF2NO3 |
| Molecular Weight | 273.62 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 5-(3-chloro-2,6-difluoro-5-methylphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(F)c(-c2cc(C(=O)O)no2)c1F |
| InChI | InChI=1S/C11H6ClF2NO3/c1-4-2-5(12)10(14)8(9(4)13)7-3-6(11(16)17)15-18-7/h2-3H,1H3,(H,16,17) |
| InChIKey | HYOMMJGTSZRHQK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|