C10H2BrF4NO3 — CID 115111261
5-(4-bromo-2,3,5,6-tetrafluorophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115111261) has the molecular formula C10H2BrF4NO3 and a molecular weight of 340.03 g/mol. Its IUPAC name is 5-(4-bromo-2,3,5,6-tetrafluorophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(4-bromo-2,3,5,6-tetrafluorophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115111261 |
| Molecular Formula | C10H2BrF4NO3 |
| Molecular Weight | 340.03 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | 5-(4-bromo-2,3,5,6-tetrafluorophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(F)c(F)c(Br)c(F)c2F)on1 |
| InChI | InChI=1S/C10H2BrF4NO3/c11-5-8(14)6(12)4(7(13)9(5)15)3-1-2(10(17)18)16-19-3/h1H,(H,17,18) |
| InChIKey | WPWCDYYTFDINBW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.03 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|