C10H5BrFNO5 — CID 136995079
5-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 136995079) has the molecular formula C10H5BrFNO5 and a molecular weight of 318.05 g/mol. Its IUPAC name is 5-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136995079 |
| Molecular Formula | C10H5BrFNO5 |
| Molecular Weight | 318.05 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 5-(2-bromo-6-fluoro-3,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(F)cc(O)c(O)c2Br)on1 |
| InChI | InChI=1S/C10H5BrFNO5/c11-8-7(3(12)1-5(14)9(8)15)6-2-4(10(16)17)13-18-6/h1-2,14-15H,(H,16,17) |
| InChIKey | DSTLRTOHTKWGIQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.05 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|