C10H4BrF2NO3 — CID 117488817
5-(4-bromo-3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117488817) has the molecular formula C10H4BrF2NO3 and a molecular weight of 304.05 g/mol. Its IUPAC name is 5-(4-bromo-3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(4-bromo-3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117488817 |
| Molecular Formula | C10H4BrF2NO3 |
| Molecular Weight | 304.05 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 5-(4-bromo-3,5-difluorophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)c(Br)c(F)c2)on1 |
| InChI | InChI=1S/C10H4BrF2NO3/c11-9-5(12)1-4(2-6(9)13)8-3-7(10(15)16)14-17-8/h1-3H,(H,15,16) |
| InChIKey | GTGKRXUUNHPGQP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.05 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|