C10H3ClF3NO3 — CID 117445060
5-(3-chloro-2,5,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 117445060) has the molecular formula C10H3ClF3NO3 and a molecular weight of 277.59 g/mol. Its IUPAC name is 5-(3-chloro-2,5,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3-chloro-2,5,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117445060 |
| Molecular Formula | C10H3ClF3NO3 |
| Molecular Weight | 277.59 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 5-(3-chloro-2,5,6-trifluorophenyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(F)c(F)cc(Cl)c2F)on1 |
| InChI | InChI=1S/C10H3ClF3NO3/c11-3-1-4(12)9(14)7(8(3)13)6-2-5(10(16)17)15-18-6/h1-2H,(H,16,17) |
| InChIKey | GXLNNMNDGDOKKL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|