5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid

C8H4FNO3S — CID 146447163

IUPAC5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(F)s2)on1
InChIInChI=1S/C8H4FNO3S/c9-7-2-1-6(14-7)5-3-4(8(11)12)10-13-5/h1-3H,(H,11,12)
InChIKeyCPHSRWLTKZXFRN-UHFFFAOYSA-N
MW213.19 g/mol
LogP2.24
Rot. Bonds2

About 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid

5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 146447163) has the molecular formula C8H4FNO3S and a molecular weight of 213.19 g/mol. Its IUPAC name is 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid
PubChem CID146447163
Molecular FormulaC8H4FNO3S
Molecular Weight213.19 g/mol
Exact Mass212.99
IUPAC Name5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1cc(-c2ccc(F)s2)on1
InChIInChI=1S/C8H4FNO3S/c9-7-2-1-6(14-7)5-3-4(8(11)12)10-13-5/h1-3H,(H,11,12)
InChIKeyCPHSRWLTKZXFRN-UHFFFAOYSA-N
XLogP2.24
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.19
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid (CID 146447163) is 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid is O=C(O)c1cc(-c2ccc(F)s2)on1.
What is the InChIKey of 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is CPHSRWLTKZXFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO3S/c9-7-2-1-6(14-7)5-3-4(8(11)12)10-13-5/h1-3H,(H,11,12).
What are the key properties of 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid?
5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 213.19 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-fluorothiophen-2-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 146447163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).