C11H14FNO4S — CID 117439986
1-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-(methylamino)ethanone (PubChem CID 117439986) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-(methylamino)ethanone.
| Compound Name | 1-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 117439986 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-(3-fluoro-5-methoxy-4-methylsulfonylphenyl)-2-(methylamino)ethanone |
| SMILES | CNCC(=O)c1cc(F)c(S(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C11H14FNO4S/c1-13-6-9(14)7-4-8(12)11(18(3,15)16)10(5-7)17-2/h4-5,13H,6H2,1-3H3 |
| InChIKey | ULVKPYCJEJFUJB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |