C20H26N4O8 — CID 11744470
1-[10-(2-carboxy-4-nitropyrrol-1-yl)decyl]-4-nitropyrrole-2-carboxylic acid (PubChem CID 11744470) has the molecular formula C20H26N4O8 and a molecular weight of 450.45 g/mol. Its IUPAC name is 1-[10-(2-carboxy-4-nitropyrrol-1-yl)decyl]-4-nitropyrrole-2-carboxylic acid.
| Compound Name | 1-[10-(2-carboxy-4-nitropyrrol-1-yl)decyl]-4-nitropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 11744470 |
| Molecular Formula | C20H26N4O8 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[10-(2-carboxy-4-nitropyrrol-1-yl)decyl]-4-nitropyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cn1CCCCCCCCCCn1cc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C20H26N4O8/c25-19(26)17-11-15(23(29)30)13-21(17)9-7-5-3-1-2-4-6-8-10-22-14-16(24(31)32)12-18(22)20(27)28/h11-14H,1-10H2,(H,25,26)(H,27,28) |
| InChIKey | BKIIJOPPCIQBHE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 170.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|