C8H6N4O5 — CID 61294053
4-nitro-1-(1,2,4-oxadiazol-3-ylmethyl)pyrrole-2-carboxylic acid (PubChem CID 61294053) has the molecular formula C8H6N4O5 and a molecular weight of 238.16 g/mol. Its IUPAC name is 4-nitro-1-(1,2,4-oxadiazol-3-ylmethyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-nitro-1-(1,2,4-oxadiazol-3-ylmethyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61294053 |
| Molecular Formula | C8H6N4O5 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-nitro-1-(1,2,4-oxadiazol-3-ylmethyl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cn1Cc1ncon1 |
| InChI | InChI=1S/C8H6N4O5/c13-8(14)6-1-5(12(15)16)2-11(6)3-7-9-4-17-10-7/h1-2,4H,3H2,(H,13,14) |
| InChIKey | RITMWCIIDLARLV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|