C11H12N4O5 — CID 61495611
4-nitro-1-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]pyrrole-2-carboxylic acid (PubChem CID 61495611) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 4-nitro-1-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-nitro-1-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61495611 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-nitro-1-[(5-propyl-1,2,4-oxadiazol-3-yl)methyl]pyrrole-2-carboxylic acid |
| SMILES | CCCc1nc(Cn2cc([N+](=O)[O-])cc2C(=O)O)no1 |
| InChI | InChI=1S/C11H12N4O5/c1-2-3-10-12-9(13-20-10)6-14-5-7(15(18)19)4-8(14)11(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | ROVBCJGTLBAYRJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|