C22H25FO4Se — CID 11744523
Se-methyl (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-3,11-dioxo-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboselenoate (PubChem CID 11744523) has the molecular formula C22H25FO4Se and a molecular weight of 451.40 g/mol. Its IUPAC name is Se-methyl (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-3,11-dioxo-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboselenoate.
| Compound Name | Se-methyl (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-3,11-dioxo-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboselenoate |
|---|---|
| PubChem CID | 11744523 |
| Molecular Formula | C22H25FO4Se |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | Se-methyl (8S,9R,10S,13S,14S,17R)-9-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-3,11-dioxo-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboselenoate |
| SMILES | C=C1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@]2(C)[C@@]1(O)C(=O)[Se]C |
| InChI | InChI=1S/C22H25FO4Se/c1-12-9-16-15-6-5-13-10-14(24)7-8-19(13,2)21(15,23)17(25)11-20(16,3)22(12,27)18(26)28-4/h7-8,10,15-16,27H,1,5-6,9,11H2,2-4H3/t15-,16-,19-,20-,21-,22-/m0/s1 |
| InChIKey | GWKBNMHGIJRWOL-VWCSCAALSA-N |
| XLogP | 2.74 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|