C26H32ClFO7 — CID 18644069
chloromethyl (8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propan-2-yloxycarbonyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18644069) has the molecular formula C26H32ClFO7 and a molecular weight of 510.99 g/mol. Its IUPAC name is chloromethyl (8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propan-2-yloxycarbonyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propan-2-yloxycarbonyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18644069 |
| Molecular Formula | C26H32ClFO7 |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | chloromethyl (8S,9R,10S,13S,14S,16R,17R)-9-fluoro-10,13,16-trimethyl-3,11-dioxo-17-propan-2-yloxycarbonyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(C)OC(=O)O[C@]1(C(=O)OCCl)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@@]21C |
| InChI | InChI=1S/C26H32ClFO7/c1-14(2)34-22(32)35-26(21(31)33-13-27)15(3)10-19-18-7-6-16-11-17(29)8-9-23(16,4)25(18,28)20(30)12-24(19,26)5/h8-9,11,14-15,18-19H,6-7,10,12-13H2,1-5H3/t15-,18+,19+,23+,24+,25+,26+/m1/s1 |
| InChIKey | ZOOUTSIGBVGABN-WAQYWSKUSA-N |
| XLogP | 4.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|