C15H16ClNO2 — CID 117445308
1-(3-chloro-1H-indol-5-yl)cyclohexane-1-carboxylic acid (PubChem CID 117445308) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-(3-chloro-1H-indol-5-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(3-chloro-1H-indol-5-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117445308 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(3-chloro-1H-indol-5-yl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc3[nH]cc(Cl)c3c2)CCCCC1 |
| InChI | InChI=1S/C15H16ClNO2/c16-12-9-17-13-5-4-10(8-11(12)13)15(14(18)19)6-2-1-3-7-15/h4-5,8-9,17H,1-3,6-7H2,(H,18,19) |
| InChIKey | VMJATTKAVWLQPQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |