C20H16ClNO3 — CID 86698747
1-[4-(6-chloro-3-formyl-1H-indol-5-yl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 86698747) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is 1-[4-(6-chloro-3-formyl-1H-indol-5-yl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[4-(6-chloro-3-formyl-1H-indol-5-yl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 86698747 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1-[4-(6-chloro-3-formyl-1H-indol-5-yl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | O=Cc1c[nH]c2cc(Cl)c(-c3ccc(C4(C(=O)O)CCC4)cc3)cc12 |
| InChI | InChI=1S/C20H16ClNO3/c21-17-9-18-16(13(11-23)10-22-18)8-15(17)12-2-4-14(5-3-12)20(19(24)25)6-1-7-20/h2-5,8-11,22H,1,6-7H2,(H,24,25) |
| InChIKey | NKVBEDQEOSGEAF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|