C20H18ClNO4 — CID 71766241
6-chloro-5-[4-(1-hydroxycyclobutyl)-3-methoxyphenyl]-1H-indole-3-carboxylic acid (PubChem CID 71766241) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 6-chloro-5-[4-(1-hydroxycyclobutyl)-3-methoxyphenyl]-1H-indole-3-carboxylic acid.
| Compound Name | 6-chloro-5-[4-(1-hydroxycyclobutyl)-3-methoxyphenyl]-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 71766241 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 6-chloro-5-[4-(1-hydroxycyclobutyl)-3-methoxyphenyl]-1H-indole-3-carboxylic acid |
| SMILES | COc1cc(-c2cc3c(C(=O)O)c[nH]c3cc2Cl)ccc1C1(O)CCC1 |
| InChI | InChI=1S/C20H18ClNO4/c1-26-18-7-11(3-4-15(18)20(25)5-2-6-20)12-8-13-14(19(23)24)10-22-17(13)9-16(12)21/h3-4,7-10,22,25H,2,5-6H2,1H3,(H,23,24) |
| InChIKey | KMRDDGOECBQZPA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |