C12H12BrN3 — CID 117445640
5-(6-bromo-2,3-dihydro-1H-inden-4-yl)-1H-pyrazol-3-amine (PubChem CID 117445640) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 5-(6-bromo-2,3-dihydro-1H-inden-4-yl)-1H-pyrazol-3-amine.
| Compound Name | 5-(6-bromo-2,3-dihydro-1H-inden-4-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117445640 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 5-(6-bromo-2,3-dihydro-1H-inden-4-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2cc(Br)cc3c2CCC3)[nH]n1 |
| InChI | InChI=1S/C12H12BrN3/c13-8-4-7-2-1-3-9(7)10(5-8)11-6-12(14)16-15-11/h4-6H,1-3H2,(H3,14,15,16) |
| InChIKey | GHRXBBFJUZRFRP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |