C15H22N2OS — CID 117446768
1-[2-(2,2-dimethyl-1,3-benzoxathiol-6-yl)ethyl]piperazine (PubChem CID 117446768) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-[2-(2,2-dimethyl-1,3-benzoxathiol-6-yl)ethyl]piperazine.
| Compound Name | 1-[2-(2,2-dimethyl-1,3-benzoxathiol-6-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 117446768 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-[2-(2,2-dimethyl-1,3-benzoxathiol-6-yl)ethyl]piperazine |
| SMILES | CC1(C)Oc2cc(CCN3CCNCC3)ccc2S1 |
| InChI | InChI=1S/C15H22N2OS/c1-15(2)18-13-11-12(3-4-14(13)19-15)5-8-17-9-6-16-7-10-17/h3-4,11,16H,5-10H2,1-2H3 |
| InChIKey | SPVVPYCOABKBOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |