C17H29NO2 — CID 117448513
O-[2-[2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]hydroxylamine (PubChem CID 117448513) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is O-[2-[2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]hydroxylamine.
| Compound Name | O-[2-[2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117448513 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | O-[2-[2-methoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]ethyl]hydroxylamine |
| SMILES | COc1ccc(C(C)(C)CC(C)(C)C)cc1CCON |
| InChI | InChI=1S/C17H29NO2/c1-16(2,3)12-17(4,5)14-7-8-15(19-6)13(11-14)9-10-20-18/h7-8,11H,9-10,12,18H2,1-6H3 |
| InChIKey | CXOFHFYIHLJPRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|